C16H17BrN2O5S — CID 110517434
N-[(E)-(3-bromo-4-methoxyphenyl)methylideneamino]-3,4-dimethoxybenzenesulfonamide (PubChem CID 110517434) has the molecular formula C16H17BrN2O5S and a molecular weight of 429.29 g/mol. Its IUPAC name is N-[(E)-(3-bromo-4-methoxyphenyl)methylideneamino]-3,4-dimethoxybenzenesulfonamide.
| Compound Name | N-[(E)-(3-bromo-4-methoxyphenyl)methylideneamino]-3,4-dimethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 110517434 |
| Molecular Formula | C16H17BrN2O5S |
| Molecular Weight | 429.29 g/mol |
| Exact Mass | 428.00 |
| IUPAC Name | N-[(E)-(3-bromo-4-methoxyphenyl)methylideneamino]-3,4-dimethoxybenzenesulfonamide |
| SMILES | COc1ccc(/C=N/NS(=O)(=O)c2ccc(OC)c(OC)c2)cc1Br |
| InChI | InChI=1S/C16H17BrN2O5S/c1-22-14-6-4-11(8-13(14)17)10-18-19-25(20,21)12-5-7-15(23-2)16(9-12)24-3/h4-10,19H,1-3H3/b18-10+ |
| InChIKey | RPNLLXRDVSPRJS-VCHYOVAHSA-N |
| XLogP | 2.79 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.29 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|