C15H15N3O6S — CID 110517562
3,4-dimethoxy-N-[(E)-(4-nitrophenyl)methylideneamino]benzenesulfonamide (PubChem CID 110517562) has the molecular formula C15H15N3O6S and a molecular weight of 365.37 g/mol. Its IUPAC name is 3,4-dimethoxy-N-[(E)-(4-nitrophenyl)methylideneamino]benzenesulfonamide.
| Compound Name | 3,4-dimethoxy-N-[(E)-(4-nitrophenyl)methylideneamino]benzenesulfonamide |
|---|---|
| PubChem CID | 110517562 |
| Molecular Formula | C15H15N3O6S |
| Molecular Weight | 365.37 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | 3,4-dimethoxy-N-[(E)-(4-nitrophenyl)methylideneamino]benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)N/N=C/c2ccc([N+](=O)[O-])cc2)cc1OC |
| InChI | InChI=1S/C15H15N3O6S/c1-23-14-8-7-13(9-15(14)24-2)25(21,22)17-16-10-11-3-5-12(6-4-11)18(19)20/h3-10,17H,1-2H3/b16-10+ |
| InChIKey | YXKKGWCHYQCOAT-MHWRWJLKSA-N |
| XLogP | 1.92 |
| TPSA | 120.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.37 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|