C15H14BrN3O4 — CID 124605350
N-[(Z)-(3-bromo-4,5-dimethoxyphenyl)methylideneamino]-4-nitroaniline (PubChem CID 124605350) has the molecular formula C15H14BrN3O4 and a molecular weight of 380.20 g/mol. Its IUPAC name is N-[(Z)-(3-bromo-4,5-dimethoxyphenyl)methylideneamino]-4-nitroaniline.
| Compound Name | N-[(Z)-(3-bromo-4,5-dimethoxyphenyl)methylideneamino]-4-nitroaniline |
|---|---|
| PubChem CID | 124605350 |
| Molecular Formula | C15H14BrN3O4 |
| Molecular Weight | 380.20 g/mol |
| Exact Mass | 379.02 |
| IUPAC Name | N-[(Z)-(3-bromo-4,5-dimethoxyphenyl)methylideneamino]-4-nitroaniline |
| SMILES | COc1cc(/C=N\Nc2ccc([N+](=O)[O-])cc2)cc(Br)c1OC |
| InChI | InChI=1S/C15H14BrN3O4/c1-22-14-8-10(7-13(16)15(14)23-2)9-17-18-11-3-5-12(6-4-11)19(20)21/h3-9,18H,1-2H3/b17-9- |
| InChIKey | BRRDQAUVKJUKIN-MFOYZWKCSA-N |
| XLogP | 3.82 |
| TPSA | 85.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.20 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|