C15H13Cl2N3O5S — CID 110517346
N-[(E)-(3,5-dichloro-4-ethoxyphenyl)methylideneamino]-3-nitrobenzenesulfonamide (PubChem CID 110517346) has the molecular formula C15H13Cl2N3O5S and a molecular weight of 418.26 g/mol. Its IUPAC name is N-[(E)-(3,5-dichloro-4-ethoxyphenyl)methylideneamino]-3-nitrobenzenesulfonamide.
| Compound Name | N-[(E)-(3,5-dichloro-4-ethoxyphenyl)methylideneamino]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 110517346 |
| Molecular Formula | C15H13Cl2N3O5S |
| Molecular Weight | 418.26 g/mol |
| Exact Mass | 417.00 |
| IUPAC Name | N-[(E)-(3,5-dichloro-4-ethoxyphenyl)methylideneamino]-3-nitrobenzenesulfonamide |
| SMILES | CCOc1c(Cl)cc(/C=N/NS(=O)(=O)c2cccc([N+](=O)[O-])c2)cc1Cl |
| InChI | InChI=1S/C15H13Cl2N3O5S/c1-2-25-15-13(16)6-10(7-14(15)17)9-18-19-26(23,24)12-5-3-4-11(8-12)20(21)22/h3-9,19H,2H2,1H3/b18-9+ |
| InChIKey | YLZHHTBZSAVXGY-GIJQJNRQSA-N |
| XLogP | 3.61 |
| TPSA | 110.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.26 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|