C17H17Cl3N2O3S — CID 110516269
4-chloro-N-[(E)-[3,5-dichloro-4-(2-methylpropoxy)phenyl]methylideneamino]benzenesulfonamide (PubChem CID 110516269) has the molecular formula C17H17Cl3N2O3S and a molecular weight of 435.76 g/mol. Its IUPAC name is 4-chloro-N-[(E)-[3,5-dichloro-4-(2-methylpropoxy)phenyl]methylideneamino]benzenesulfonamide.
| Compound Name | 4-chloro-N-[(E)-[3,5-dichloro-4-(2-methylpropoxy)phenyl]methylideneamino]benzenesulfonamide |
|---|---|
| PubChem CID | 110516269 |
| Molecular Formula | C17H17Cl3N2O3S |
| Molecular Weight | 435.76 g/mol |
| Exact Mass | 434.00 |
| IUPAC Name | 4-chloro-N-[(E)-[3,5-dichloro-4-(2-methylpropoxy)phenyl]methylideneamino]benzenesulfonamide |
| SMILES | CC(C)COc1c(Cl)cc(/C=N/NS(=O)(=O)c2ccc(Cl)cc2)cc1Cl |
| InChI | InChI=1S/C17H17Cl3N2O3S/c1-11(2)10-25-17-15(19)7-12(8-16(17)20)9-21-22-26(23,24)14-5-3-13(18)4-6-14/h3-9,11,22H,10H2,1-2H3/b21-9+ |
| InChIKey | QOYBBKNVTVLCQZ-ZVBGSRNCSA-N |
| XLogP | 4.99 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.76 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|