C18H21ClN2O4S — CID 110517026
5-chloro-2-methoxy-N-[(E)-[4-(2-methylpropoxy)phenyl]methylideneamino]benzenesulfonamide (PubChem CID 110517026) has the molecular formula C18H21ClN2O4S and a molecular weight of 396.90 g/mol. Its IUPAC name is 5-chloro-2-methoxy-N-[(E)-[4-(2-methylpropoxy)phenyl]methylideneamino]benzenesulfonamide.
| Compound Name | 5-chloro-2-methoxy-N-[(E)-[4-(2-methylpropoxy)phenyl]methylideneamino]benzenesulfonamide |
|---|---|
| PubChem CID | 110517026 |
| Molecular Formula | C18H21ClN2O4S |
| Molecular Weight | 396.90 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | 5-chloro-2-methoxy-N-[(E)-[4-(2-methylpropoxy)phenyl]methylideneamino]benzenesulfonamide |
| SMILES | COc1ccc(Cl)cc1S(=O)(=O)N/N=C/c1ccc(OCC(C)C)cc1 |
| InChI | InChI=1S/C18H21ClN2O4S/c1-13(2)12-25-16-7-4-14(5-8-16)11-20-21-26(22,23)18-10-15(19)6-9-17(18)24-3/h4-11,13,21H,12H2,1-3H3/b20-11+ |
| InChIKey | AKPZORMVYSWBPG-RGVLZGJSSA-N |
| XLogP | 3.70 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.90 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|