C18H20Cl2N2O5S — CID 110516571
N-[(E)-(3,5-dichloro-4-propan-2-yloxyphenyl)methylideneamino]-2,5-dimethoxybenzenesulfonamide (PubChem CID 110516571) has the molecular formula C18H20Cl2N2O5S and a molecular weight of 447.34 g/mol. Its IUPAC name is N-[(E)-(3,5-dichloro-4-propan-2-yloxyphenyl)methylideneamino]-2,5-dimethoxybenzenesulfonamide.
| Compound Name | N-[(E)-(3,5-dichloro-4-propan-2-yloxyphenyl)methylideneamino]-2,5-dimethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 110516571 |
| Molecular Formula | C18H20Cl2N2O5S |
| Molecular Weight | 447.34 g/mol |
| Exact Mass | 446.05 |
| IUPAC Name | N-[(E)-(3,5-dichloro-4-propan-2-yloxyphenyl)methylideneamino]-2,5-dimethoxybenzenesulfonamide |
| SMILES | COc1ccc(OC)c(S(=O)(=O)N/N=C/c2cc(Cl)c(OC(C)C)c(Cl)c2)c1 |
| InChI | InChI=1S/C18H20Cl2N2O5S/c1-11(2)27-18-14(19)7-12(8-15(18)20)10-21-22-28(23,24)17-9-13(25-3)5-6-16(17)26-4/h5-11,22H,1-4H3/b21-10+ |
| InChIKey | JLUHXHALLYJQKA-UFFVCSGVSA-N |
| XLogP | 4.11 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.34 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|