C15H13Cl3N2O4S — CID 110516624
2,5-dimethoxy-N-[(E)-(2,3,6-trichlorophenyl)methylideneamino]benzenesulfonamide (PubChem CID 110516624) has the molecular formula C15H13Cl3N2O4S and a molecular weight of 423.71 g/mol. Its IUPAC name is 2,5-dimethoxy-N-[(E)-(2,3,6-trichlorophenyl)methylideneamino]benzenesulfonamide.
| Compound Name | 2,5-dimethoxy-N-[(E)-(2,3,6-trichlorophenyl)methylideneamino]benzenesulfonamide |
|---|---|
| PubChem CID | 110516624 |
| Molecular Formula | C15H13Cl3N2O4S |
| Molecular Weight | 423.71 g/mol |
| Exact Mass | 421.97 |
| IUPAC Name | 2,5-dimethoxy-N-[(E)-(2,3,6-trichlorophenyl)methylideneamino]benzenesulfonamide |
| SMILES | COc1ccc(OC)c(S(=O)(=O)N/N=C/c2c(Cl)ccc(Cl)c2Cl)c1 |
| InChI | InChI=1S/C15H13Cl3N2O4S/c1-23-9-3-6-13(24-2)14(7-9)25(21,22)20-19-8-10-11(16)4-5-12(17)15(10)18/h3-8,20H,1-2H3/b19-8+ |
| InChIKey | ZHVURAXFBYYOLF-UFWORHAWSA-N |
| XLogP | 3.98 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.71 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|