C15H18N2O4S2 — CID 6170879
N-[(Z)-(5-ethylthiophen-2-yl)methylideneamino]-2,5-dimethoxybenzenesulfonamide (PubChem CID 6170879) has the molecular formula C15H18N2O4S2 and a molecular weight of 354.45 g/mol. Its IUPAC name is N-[(Z)-(5-ethylthiophen-2-yl)methylideneamino]-2,5-dimethoxybenzenesulfonamide.
| Compound Name | N-[(Z)-(5-ethylthiophen-2-yl)methylideneamino]-2,5-dimethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 6170879 |
| Molecular Formula | C15H18N2O4S2 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | N-[(Z)-(5-ethylthiophen-2-yl)methylideneamino]-2,5-dimethoxybenzenesulfonamide |
| SMILES | CCc1ccc(/C=N\NS(=O)(=O)c2cc(OC)ccc2OC)s1 |
| InChI | InChI=1S/C15H18N2O4S2/c1-4-12-6-7-13(22-12)10-16-17-23(18,19)15-9-11(20-2)5-8-14(15)21-3/h5-10,17H,4H2,1-3H3/b16-10- |
| InChIKey | XRALTXUGCJHFDX-YBEGLDIGSA-N |
| XLogP | 2.64 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|