C18H20ClFN2O4S — CID 110516392
N-[(E)-(3-chloro-5-ethoxy-4-propoxyphenyl)methylideneamino]-4-fluorobenzenesulfonamide (PubChem CID 110516392) has the molecular formula C18H20ClFN2O4S and a molecular weight of 414.89 g/mol. Its IUPAC name is N-[(E)-(3-chloro-5-ethoxy-4-propoxyphenyl)methylideneamino]-4-fluorobenzenesulfonamide.
| Compound Name | N-[(E)-(3-chloro-5-ethoxy-4-propoxyphenyl)methylideneamino]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 110516392 |
| Molecular Formula | C18H20ClFN2O4S |
| Molecular Weight | 414.89 g/mol |
| Exact Mass | 414.08 |
| IUPAC Name | N-[(E)-(3-chloro-5-ethoxy-4-propoxyphenyl)methylideneamino]-4-fluorobenzenesulfonamide |
| SMILES | CCCOc1c(Cl)cc(/C=N/NS(=O)(=O)c2ccc(F)cc2)cc1OCC |
| InChI | InChI=1S/C18H20ClFN2O4S/c1-3-9-26-18-16(19)10-13(11-17(18)25-4-2)12-21-22-27(23,24)15-7-5-14(20)6-8-15/h5-8,10-12,22H,3-4,9H2,1-2H3/b21-12+ |
| InChIKey | JMIZMJUZTCKCCY-CIAFOILYSA-N |
| XLogP | 3.98 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.89 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|