C15H15KN2O5S — CID 135458846
potassium 4-[(2E)-2-[(3-ethoxy-4-hydroxyphenyl)methylidene]hydrazinyl]benzenesulfonate (PubChem CID 135458846) has the molecular formula C15H15KN2O5S and a molecular weight of 374.46 g/mol. Its IUPAC name is potassium 4-[(2E)-2-[(3-ethoxy-4-hydroxyphenyl)methylidene]hydrazinyl]benzenesulfonate.
| Compound Name | potassium 4-[(2E)-2-[(3-ethoxy-4-hydroxyphenyl)methylidene]hydrazinyl]benzenesulfonate |
|---|---|
| PubChem CID | 135458846 |
| Molecular Formula | C15H15KN2O5S |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.03 |
| IUPAC Name | potassium 4-[(2E)-2-[(3-ethoxy-4-hydroxyphenyl)methylidene]hydrazinyl]benzenesulfonate |
| SMILES | CCOc1cc(/C=N/Nc2ccc(S(=O)(=O)[O-])cc2)ccc1O.[K+] |
| InChI | InChI=1S/C15H16N2O5S.K/c1-2-22-15-9-11(3-8-14(15)18)10-16-17-12-4-6-13(7-5-12)23(19,20)21;/h3-10,17-18H,2H2,1H3,(H,19,20,21);/q;+1/p-1/b16-10+; |
| InChIKey | DACZYKAEKLSASZ-QFHYWFJHSA-M |
| XLogP | -0.86 |
| TPSA | 111.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|