C22H26N4O6 — CID 135884833
N,N'-bis[(Z)-(3-ethoxy-4-hydroxyphenyl)methylideneamino]butanediamide (PubChem CID 135884833) has the molecular formula C22H26N4O6 and a molecular weight of 442.47 g/mol. Its IUPAC name is N,N'-bis[(Z)-(3-ethoxy-4-hydroxyphenyl)methylideneamino]butanediamide.
| Compound Name | N,N'-bis[(Z)-(3-ethoxy-4-hydroxyphenyl)methylideneamino]butanediamide |
|---|---|
| PubChem CID | 135884833 |
| Molecular Formula | C22H26N4O6 |
| Molecular Weight | 442.47 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | N,N'-bis[(Z)-(3-ethoxy-4-hydroxyphenyl)methylideneamino]butanediamide |
| SMILES | CCOc1cc(/C=N\NC(=O)CCC(=O)N/N=C\c2ccc(O)c(OCC)c2)ccc1O |
| InChI | InChI=1S/C22H26N4O6/c1-3-31-19-11-15(5-7-17(19)27)13-23-25-21(29)9-10-22(30)26-24-14-16-6-8-18(28)20(12-16)32-4-2/h5-8,11-14,27-28H,3-4,9-10H2,1-2H3,(H,25,29)(H,26,30)/b23-13-,24-14- |
| InChIKey | IIQPYZMYACLGGM-GACBQCINSA-N |
| XLogP | 2.28 |
| TPSA | 141.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.47 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|