C20H25NO4S — CID 110518910
(NZ)-N-[(3-methoxy-4-pentoxyphenyl)methylidene]-4-methylbenzenesulfonamide (PubChem CID 110518910) has the molecular formula C20H25NO4S and a molecular weight of 375.49 g/mol. Its IUPAC name is (NZ)-N-[(3-methoxy-4-pentoxyphenyl)methylidene]-4-methylbenzenesulfonamide.
| Compound Name | (NZ)-N-[(3-methoxy-4-pentoxyphenyl)methylidene]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 110518910 |
| Molecular Formula | C20H25NO4S |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | (NZ)-N-[(3-methoxy-4-pentoxyphenyl)methylidene]-4-methylbenzenesulfonamide |
| SMILES | CCCCCOc1ccc(/C=N\S(=O)(=O)c2ccc(C)cc2)cc1OC |
| InChI | InChI=1S/C20H25NO4S/c1-4-5-6-13-25-19-12-9-17(14-20(19)24-3)15-21-26(22,23)18-10-7-16(2)8-11-18/h7-12,14-15H,4-6,13H2,1-3H3/b21-15- |
| InChIKey | OQYPPMJKIBQYQL-QNGOZBTKSA-N |
| XLogP | 4.38 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|