C30H35NO5S — CID 19211725
(E)-N-(4-ethylphenyl)-3-(3-methoxy-4-pentoxyphenyl)-N-(4-methylphenyl)sulfonylprop-2-enamide (PubChem CID 19211725) has the molecular formula C30H35NO5S and a molecular weight of 521.68 g/mol. Its IUPAC name is (E)-N-(4-ethylphenyl)-3-(3-methoxy-4-pentoxyphenyl)-N-(4-methylphenyl)sulfonylprop-2-enamide.
| Compound Name | (E)-N-(4-ethylphenyl)-3-(3-methoxy-4-pentoxyphenyl)-N-(4-methylphenyl)sulfonylprop-2-enamide |
|---|---|
| PubChem CID | 19211725 |
| Molecular Formula | C30H35NO5S |
| Molecular Weight | 521.68 g/mol |
| Exact Mass | 521.22 |
| IUPAC Name | (E)-N-(4-ethylphenyl)-3-(3-methoxy-4-pentoxyphenyl)-N-(4-methylphenyl)sulfonylprop-2-enamide |
| SMILES | CCCCCOc1ccc(/C=C/C(=O)N(c2ccc(CC)cc2)S(=O)(=O)c2ccc(C)cc2)cc1OC |
| InChI | InChI=1S/C30H35NO5S/c1-5-7-8-21-36-28-19-13-25(22-29(28)35-4)14-20-30(32)31(26-15-11-24(6-2)12-16-26)37(33,34)27-17-9-23(3)10-18-27/h9-20,22H,5-8,21H2,1-4H3/b20-14+ |
| InChIKey | OKDCGOYZZMDXKF-XSFVSMFZSA-N |
| XLogP | 6.57 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.68 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|