C26H27NO4S — CID 19212224
(E)-N-(4-methylphenyl)-N-(4-methylphenyl)sulfonyl-3-(4-propoxyphenyl)prop-2-enamide (PubChem CID 19212224) has the molecular formula C26H27NO4S and a molecular weight of 449.57 g/mol. Its IUPAC name is (E)-N-(4-methylphenyl)-N-(4-methylphenyl)sulfonyl-3-(4-propoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-(4-methylphenyl)-N-(4-methylphenyl)sulfonyl-3-(4-propoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 19212224 |
| Molecular Formula | C26H27NO4S |
| Molecular Weight | 449.57 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | (E)-N-(4-methylphenyl)-N-(4-methylphenyl)sulfonyl-3-(4-propoxyphenyl)prop-2-enamide |
| SMILES | CCCOc1ccc(/C=C/C(=O)N(c2ccc(C)cc2)S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C26H27NO4S/c1-4-19-31-24-14-9-22(10-15-24)11-18-26(28)27(23-12-5-20(2)6-13-23)32(29,30)25-16-7-21(3)8-17-25/h5-18H,4,19H2,1-3H3/b18-11+ |
| InChIKey | NURUPZWMKAURNN-WOJGMQOQSA-N |
| XLogP | 5.53 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.57 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|