C23H21NO5S — CID 19211692
(E)-N-(benzenesulfonyl)-N,3-bis(4-methoxyphenyl)prop-2-enamide (PubChem CID 19211692) has the molecular formula C23H21NO5S and a molecular weight of 423.49 g/mol. Its IUPAC name is (E)-N-(benzenesulfonyl)-N,3-bis(4-methoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-(benzenesulfonyl)-N,3-bis(4-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 19211692 |
| Molecular Formula | C23H21NO5S |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | (E)-N-(benzenesulfonyl)-N,3-bis(4-methoxyphenyl)prop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)N(c2ccc(OC)cc2)S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H21NO5S/c1-28-20-13-8-18(9-14-20)10-17-23(25)24(19-11-15-21(29-2)16-12-19)30(26,27)22-6-4-3-5-7-22/h3-17H,1-2H3/b17-10+ |
| InChIKey | YNNZOLJHBYJBEJ-LICLKQGHSA-N |
| XLogP | 4.14 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|