C26H26BrNO4S — CID 19211971
(E)-N-(benzenesulfonyl)-3-(3-bromo-4-methoxyphenyl)-N-(4-butylphenyl)prop-2-enamide (PubChem CID 19211971) has the molecular formula C26H26BrNO4S and a molecular weight of 528.47 g/mol. Its IUPAC name is (E)-N-(benzenesulfonyl)-3-(3-bromo-4-methoxyphenyl)-N-(4-butylphenyl)prop-2-enamide.
| Compound Name | (E)-N-(benzenesulfonyl)-3-(3-bromo-4-methoxyphenyl)-N-(4-butylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 19211971 |
| Molecular Formula | C26H26BrNO4S |
| Molecular Weight | 528.47 g/mol |
| Exact Mass | 527.08 |
| IUPAC Name | (E)-N-(benzenesulfonyl)-3-(3-bromo-4-methoxyphenyl)-N-(4-butylphenyl)prop-2-enamide |
| SMILES | CCCCc1ccc(N(C(=O)/C=C/c2ccc(OC)c(Br)c2)S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H26BrNO4S/c1-3-4-8-20-11-15-22(16-12-20)28(33(30,31)23-9-6-5-7-10-23)26(29)18-14-21-13-17-25(32-2)24(27)19-21/h5-7,9-19H,3-4,8H2,1-2H3/b18-14+ |
| InChIKey | PGEJTACMHKYWGG-NBVRZTHBSA-N |
| XLogP | 6.24 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.47 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|