C29H33NO5S — CID 19211737
(E)-N-(benzenesulfonyl)-N-(2,5-dimethylphenyl)-3-(3-methoxy-4-pentoxyphenyl)prop-2-enamide (PubChem CID 19211737) has the molecular formula C29H33NO5S and a molecular weight of 507.65 g/mol. Its IUPAC name is (E)-N-(benzenesulfonyl)-N-(2,5-dimethylphenyl)-3-(3-methoxy-4-pentoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-(benzenesulfonyl)-N-(2,5-dimethylphenyl)-3-(3-methoxy-4-pentoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 19211737 |
| Molecular Formula | C29H33NO5S |
| Molecular Weight | 507.65 g/mol |
| Exact Mass | 507.21 |
| IUPAC Name | (E)-N-(benzenesulfonyl)-N-(2,5-dimethylphenyl)-3-(3-methoxy-4-pentoxyphenyl)prop-2-enamide |
| SMILES | CCCCCOc1ccc(/C=C/C(=O)N(c2cc(C)ccc2C)S(=O)(=O)c2ccccc2)cc1OC |
| InChI | InChI=1S/C29H33NO5S/c1-5-6-10-19-35-27-17-15-24(21-28(27)34-4)16-18-29(31)30(26-20-22(2)13-14-23(26)3)36(32,33)25-11-8-7-9-12-25/h7-9,11-18,20-21H,5-6,10,19H2,1-4H3/b18-16+ |
| InChIKey | MXCZEAQHWZOQCS-FBMGVBCBSA-N |
| XLogP | 6.32 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.65 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|