C29H32ClNO5S — CID 4168796
N-(4-chlorophenyl)sulfonyl-N-(2,5-dimethylphenyl)-3-[3-methoxy-4-(3-methylbutoxy)phenyl]prop-2-enamide (PubChem CID 4168796) has the molecular formula C29H32ClNO5S and a molecular weight of 542.10 g/mol. Its IUPAC name is N-(4-chlorophenyl)sulfonyl-N-(2,5-dimethylphenyl)-3-[3-methoxy-4-(3-methylbutoxy)phenyl]prop-2-enamide.
| Compound Name | N-(4-chlorophenyl)sulfonyl-N-(2,5-dimethylphenyl)-3-[3-methoxy-4-(3-methylbutoxy)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 4168796 |
| Molecular Formula | C29H32ClNO5S |
| Molecular Weight | 542.10 g/mol |
| Exact Mass | 541.17 |
| IUPAC Name | N-(4-chlorophenyl)sulfonyl-N-(2,5-dimethylphenyl)-3-[3-methoxy-4-(3-methylbutoxy)phenyl]prop-2-enamide |
| SMILES | COc1cc(C=CC(=O)N(c2cc(C)ccc2C)S(=O)(=O)c2ccc(Cl)cc2)ccc1OCCC(C)C |
| InChI | InChI=1S/C29H32ClNO5S/c1-20(2)16-17-36-27-14-8-23(19-28(27)35-5)9-15-29(32)31(26-18-21(3)6-7-22(26)4)37(33,34)25-12-10-24(30)11-13-25/h6-15,18-20H,16-17H2,1-5H3 |
| InChIKey | BIPDUDFBGUWESK-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.10 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|