C25H26ClNO4S — CID 19218729
N-(4-chlorophenyl)sulfonyl-N-(2,5-dimethylphenyl)-4-(3-methylphenoxy)butanamide (PubChem CID 19218729) has the molecular formula C25H26ClNO4S and a molecular weight of 472.01 g/mol. Its IUPAC name is N-(4-chlorophenyl)sulfonyl-N-(2,5-dimethylphenyl)-4-(3-methylphenoxy)butanamide.
| Compound Name | N-(4-chlorophenyl)sulfonyl-N-(2,5-dimethylphenyl)-4-(3-methylphenoxy)butanamide |
|---|---|
| PubChem CID | 19218729 |
| Molecular Formula | C25H26ClNO4S |
| Molecular Weight | 472.01 g/mol |
| Exact Mass | 471.13 |
| IUPAC Name | N-(4-chlorophenyl)sulfonyl-N-(2,5-dimethylphenyl)-4-(3-methylphenoxy)butanamide |
| SMILES | Cc1cccc(OCCCC(=O)N(c2cc(C)ccc2C)S(=O)(=O)c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C25H26ClNO4S/c1-18-6-4-7-22(16-18)31-15-5-8-25(28)27(24-17-19(2)9-10-20(24)3)32(29,30)23-13-11-21(26)12-14-23/h4,6-7,9-14,16-17H,5,8,15H2,1-3H3 |
| InChIKey | XXHWTANNMMXARX-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.01 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|