C26H29NO5S — CID 19218720
N-(4-ethoxyphenyl)-4-(3-methylphenoxy)-N-(4-methylphenyl)sulfonylbutanamide (PubChem CID 19218720) has the molecular formula C26H29NO5S and a molecular weight of 467.59 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-4-(3-methylphenoxy)-N-(4-methylphenyl)sulfonylbutanamide.
| Compound Name | N-(4-ethoxyphenyl)-4-(3-methylphenoxy)-N-(4-methylphenyl)sulfonylbutanamide |
|---|---|
| PubChem CID | 19218720 |
| Molecular Formula | C26H29NO5S |
| Molecular Weight | 467.59 g/mol |
| Exact Mass | 467.18 |
| IUPAC Name | N-(4-ethoxyphenyl)-4-(3-methylphenoxy)-N-(4-methylphenyl)sulfonylbutanamide |
| SMILES | CCOc1ccc(N(C(=O)CCCOc2cccc(C)c2)S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C26H29NO5S/c1-4-31-23-14-12-22(13-15-23)27(33(29,30)25-16-10-20(2)11-17-25)26(28)9-6-18-32-24-8-5-7-21(3)19-24/h5,7-8,10-17,19H,4,6,9,18H2,1-3H3 |
| InChIKey | ZUSXDLVXXJZQJE-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.59 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|