C24H25NO6S — CID 19220163
N-(4-ethoxyphenyl)-2-(3-methoxyphenoxy)-N-(4-methylphenyl)sulfonylacetamide (PubChem CID 19220163) has the molecular formula C24H25NO6S and a molecular weight of 455.53 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-2-(3-methoxyphenoxy)-N-(4-methylphenyl)sulfonylacetamide.
| Compound Name | N-(4-ethoxyphenyl)-2-(3-methoxyphenoxy)-N-(4-methylphenyl)sulfonylacetamide |
|---|---|
| PubChem CID | 19220163 |
| Molecular Formula | C24H25NO6S |
| Molecular Weight | 455.53 g/mol |
| Exact Mass | 455.14 |
| IUPAC Name | N-(4-ethoxyphenyl)-2-(3-methoxyphenoxy)-N-(4-methylphenyl)sulfonylacetamide |
| SMILES | CCOc1ccc(N(C(=O)COc2cccc(OC)c2)S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C24H25NO6S/c1-4-30-20-12-10-19(11-13-20)25(32(27,28)23-14-8-18(2)9-15-23)24(26)17-31-22-7-5-6-21(16-22)29-3/h5-16H,4,17H2,1-3H3 |
| InChIKey | RECLVBLOLRRZSI-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.53 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |