C23H22ClNO6S — CID 19219172
N-(4-chlorophenyl)sulfonyl-2-(4-ethoxyphenoxy)-N-(4-methoxyphenyl)acetamide (PubChem CID 19219172) has the molecular formula C23H22ClNO6S and a molecular weight of 475.95 g/mol. Its IUPAC name is N-(4-chlorophenyl)sulfonyl-2-(4-ethoxyphenoxy)-N-(4-methoxyphenyl)acetamide.
| Compound Name | N-(4-chlorophenyl)sulfonyl-2-(4-ethoxyphenoxy)-N-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 19219172 |
| Molecular Formula | C23H22ClNO6S |
| Molecular Weight | 475.95 g/mol |
| Exact Mass | 475.09 |
| IUPAC Name | N-(4-chlorophenyl)sulfonyl-2-(4-ethoxyphenoxy)-N-(4-methoxyphenyl)acetamide |
| SMILES | CCOc1ccc(OCC(=O)N(c2ccc(OC)cc2)S(=O)(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C23H22ClNO6S/c1-3-30-20-10-12-21(13-11-20)31-16-23(26)25(18-6-8-19(29-2)9-7-18)32(27,28)22-14-4-17(24)5-15-22/h4-15H,3,16H2,1-2H3 |
| InChIKey | FWAYSLXXVFQSLV-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.95 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |