C24H23Cl2NO5S — CID 19218828
4-(4-chlorophenoxy)-N-(4-chlorophenyl)sulfonyl-N-(4-ethoxyphenyl)butanamide (PubChem CID 19218828) has the molecular formula C24H23Cl2NO5S and a molecular weight of 508.42 g/mol. Its IUPAC name is 4-(4-chlorophenoxy)-N-(4-chlorophenyl)sulfonyl-N-(4-ethoxyphenyl)butanamide.
| Compound Name | 4-(4-chlorophenoxy)-N-(4-chlorophenyl)sulfonyl-N-(4-ethoxyphenyl)butanamide |
|---|---|
| PubChem CID | 19218828 |
| Molecular Formula | C24H23Cl2NO5S |
| Molecular Weight | 508.42 g/mol |
| Exact Mass | 507.07 |
| IUPAC Name | 4-(4-chlorophenoxy)-N-(4-chlorophenyl)sulfonyl-N-(4-ethoxyphenyl)butanamide |
| SMILES | CCOc1ccc(N(C(=O)CCCOc2ccc(Cl)cc2)S(=O)(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C24H23Cl2NO5S/c1-2-31-21-13-9-20(10-14-21)27(33(29,30)23-15-7-19(26)8-16-23)24(28)4-3-17-32-22-11-5-18(25)6-12-22/h5-16H,2-4,17H2,1H3 |
| InChIKey | JZBDAJZFUWIOON-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.42 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|