C27H31NO5S — CID 19218975
4-(2,4-dimethylphenoxy)-N-(4-ethoxyphenyl)-N-(4-methylphenyl)sulfonylbutanamide (PubChem CID 19218975) has the molecular formula C27H31NO5S and a molecular weight of 481.61 g/mol. Its IUPAC name is 4-(2,4-dimethylphenoxy)-N-(4-ethoxyphenyl)-N-(4-methylphenyl)sulfonylbutanamide.
| Compound Name | 4-(2,4-dimethylphenoxy)-N-(4-ethoxyphenyl)-N-(4-methylphenyl)sulfonylbutanamide |
|---|---|
| PubChem CID | 19218975 |
| Molecular Formula | C27H31NO5S |
| Molecular Weight | 481.61 g/mol |
| Exact Mass | 481.19 |
| IUPAC Name | 4-(2,4-dimethylphenoxy)-N-(4-ethoxyphenyl)-N-(4-methylphenyl)sulfonylbutanamide |
| SMILES | CCOc1ccc(N(C(=O)CCCOc2ccc(C)cc2C)S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C27H31NO5S/c1-5-32-24-13-11-23(12-14-24)28(34(30,31)25-15-8-20(2)9-16-25)27(29)7-6-18-33-26-17-10-21(3)19-22(26)4/h8-17,19H,5-7,18H2,1-4H3 |
| InChIKey | RPNJEFHGNSATJQ-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.61 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|