C26H29NO5S — CID 19218973
4-(2,4-dimethylphenoxy)-N-(4-methoxyphenyl)-N-(4-methylphenyl)sulfonylbutanamide (PubChem CID 19218973) has the molecular formula C26H29NO5S and a molecular weight of 467.59 g/mol. Its IUPAC name is 4-(2,4-dimethylphenoxy)-N-(4-methoxyphenyl)-N-(4-methylphenyl)sulfonylbutanamide.
| Compound Name | 4-(2,4-dimethylphenoxy)-N-(4-methoxyphenyl)-N-(4-methylphenyl)sulfonylbutanamide |
|---|---|
| PubChem CID | 19218973 |
| Molecular Formula | C26H29NO5S |
| Molecular Weight | 467.59 g/mol |
| Exact Mass | 467.18 |
| IUPAC Name | 4-(2,4-dimethylphenoxy)-N-(4-methoxyphenyl)-N-(4-methylphenyl)sulfonylbutanamide |
| SMILES | COc1ccc(N(C(=O)CCCOc2ccc(C)cc2C)S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C26H29NO5S/c1-19-7-14-24(15-8-19)33(29,30)27(22-10-12-23(31-4)13-11-22)26(28)6-5-17-32-25-16-9-20(2)18-21(25)3/h7-16,18H,5-6,17H2,1-4H3 |
| InChIKey | ORMWDHMHTWEIDI-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.59 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|