C25H26ClNO5S — CID 19219241
N-(benzenesulfonyl)-4-(4-chloro-3,5-dimethylphenoxy)-N-(4-methoxyphenyl)butanamide (PubChem CID 19219241) has the molecular formula C25H26ClNO5S and a molecular weight of 488.01 g/mol. Its IUPAC name is N-(benzenesulfonyl)-4-(4-chloro-3,5-dimethylphenoxy)-N-(4-methoxyphenyl)butanamide.
| Compound Name | N-(benzenesulfonyl)-4-(4-chloro-3,5-dimethylphenoxy)-N-(4-methoxyphenyl)butanamide |
|---|---|
| PubChem CID | 19219241 |
| Molecular Formula | C25H26ClNO5S |
| Molecular Weight | 488.01 g/mol |
| Exact Mass | 487.12 |
| IUPAC Name | N-(benzenesulfonyl)-4-(4-chloro-3,5-dimethylphenoxy)-N-(4-methoxyphenyl)butanamide |
| SMILES | COc1ccc(N(C(=O)CCCOc2cc(C)c(Cl)c(C)c2)S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H26ClNO5S/c1-18-16-22(17-19(2)25(18)26)32-15-7-10-24(28)27(20-11-13-21(31-3)14-12-20)33(29,30)23-8-5-4-6-9-23/h4-6,8-9,11-14,16-17H,7,10,15H2,1-3H3 |
| InChIKey | JCIRZGACXXUOEF-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.01 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|