C27H30ClNO4S — CID 19219251
4-(4-chloro-3,5-dimethylphenoxy)-N-(2,3-dimethylphenyl)-N-(4-methylphenyl)sulfonylbutanamide (PubChem CID 19219251) has the molecular formula C27H30ClNO4S and a molecular weight of 500.06 g/mol. Its IUPAC name is 4-(4-chloro-3,5-dimethylphenoxy)-N-(2,3-dimethylphenyl)-N-(4-methylphenyl)sulfonylbutanamide.
| Compound Name | 4-(4-chloro-3,5-dimethylphenoxy)-N-(2,3-dimethylphenyl)-N-(4-methylphenyl)sulfonylbutanamide |
|---|---|
| PubChem CID | 19219251 |
| Molecular Formula | C27H30ClNO4S |
| Molecular Weight | 500.06 g/mol |
| Exact Mass | 499.16 |
| IUPAC Name | 4-(4-chloro-3,5-dimethylphenoxy)-N-(2,3-dimethylphenyl)-N-(4-methylphenyl)sulfonylbutanamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C(=O)CCCOc2cc(C)c(Cl)c(C)c2)c2cccc(C)c2C)cc1 |
| InChI | InChI=1S/C27H30ClNO4S/c1-18-11-13-24(14-12-18)34(31,32)29(25-9-6-8-19(2)22(25)5)26(30)10-7-15-33-23-16-20(3)27(28)21(4)17-23/h6,8-9,11-14,16-17H,7,10,15H2,1-5H3 |
| InChIKey | HANOLQAPTYYFEC-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.06 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|