C24H25NO4S — CID 19218618
N-(benzenesulfonyl)-N-(2,3-dimethylphenyl)-4-phenoxybutanamide (PubChem CID 19218618) has the molecular formula C24H25NO4S and a molecular weight of 423.53 g/mol. Its IUPAC name is N-(benzenesulfonyl)-N-(2,3-dimethylphenyl)-4-phenoxybutanamide.
| Compound Name | N-(benzenesulfonyl)-N-(2,3-dimethylphenyl)-4-phenoxybutanamide |
|---|---|
| PubChem CID | 19218618 |
| Molecular Formula | C24H25NO4S |
| Molecular Weight | 423.53 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | N-(benzenesulfonyl)-N-(2,3-dimethylphenyl)-4-phenoxybutanamide |
| SMILES | Cc1cccc(N(C(=O)CCCOc2ccccc2)S(=O)(=O)c2ccccc2)c1C |
| InChI | InChI=1S/C24H25NO4S/c1-19-11-9-16-23(20(19)2)25(30(27,28)22-14-7-4-8-15-22)24(26)17-10-18-29-21-12-5-3-6-13-21/h3-9,11-16H,10,17-18H2,1-2H3 |
| InChIKey | GLBPVGLPLVNGJV-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.53 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|