C24H24ClNO4S — CID 19218621
N-(4-chlorophenyl)sulfonyl-N-(2,5-dimethylphenyl)-4-phenoxybutanamide (PubChem CID 19218621) has the molecular formula C24H24ClNO4S and a molecular weight of 457.98 g/mol. Its IUPAC name is N-(4-chlorophenyl)sulfonyl-N-(2,5-dimethylphenyl)-4-phenoxybutanamide.
| Compound Name | N-(4-chlorophenyl)sulfonyl-N-(2,5-dimethylphenyl)-4-phenoxybutanamide |
|---|---|
| PubChem CID | 19218621 |
| Molecular Formula | C24H24ClNO4S |
| Molecular Weight | 457.98 g/mol |
| Exact Mass | 457.11 |
| IUPAC Name | N-(4-chlorophenyl)sulfonyl-N-(2,5-dimethylphenyl)-4-phenoxybutanamide |
| SMILES | Cc1ccc(C)c(N(C(=O)CCCOc2ccccc2)S(=O)(=O)c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C24H24ClNO4S/c1-18-10-11-19(2)23(17-18)26(31(28,29)22-14-12-20(25)13-15-22)24(27)9-6-16-30-21-7-4-3-5-8-21/h3-5,7-8,10-15,17H,6,9,16H2,1-2H3 |
| InChIKey | CISULONRRSQBRC-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.98 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|