C26H27BrClNO4S — CID 19219662
4-(2-bromo-4-ethylphenoxy)-N-(4-chlorophenyl)sulfonyl-N-(2,5-dimethylphenyl)butanamide (PubChem CID 19219662) has the molecular formula C26H27BrClNO4S and a molecular weight of 564.93 g/mol. Its IUPAC name is 4-(2-bromo-4-ethylphenoxy)-N-(4-chlorophenyl)sulfonyl-N-(2,5-dimethylphenyl)butanamide.
| Compound Name | 4-(2-bromo-4-ethylphenoxy)-N-(4-chlorophenyl)sulfonyl-N-(2,5-dimethylphenyl)butanamide |
|---|---|
| PubChem CID | 19219662 |
| Molecular Formula | C26H27BrClNO4S |
| Molecular Weight | 564.93 g/mol |
| Exact Mass | 563.05 |
| IUPAC Name | 4-(2-bromo-4-ethylphenoxy)-N-(4-chlorophenyl)sulfonyl-N-(2,5-dimethylphenyl)butanamide |
| SMILES | CCc1ccc(OCCCC(=O)N(c2cc(C)ccc2C)S(=O)(=O)c2ccc(Cl)cc2)c(Br)c1 |
| InChI | InChI=1S/C26H27BrClNO4S/c1-4-20-9-14-25(23(27)17-20)33-15-5-6-26(30)29(24-16-18(2)7-8-19(24)3)34(31,32)22-12-10-21(28)11-13-22/h7-14,16-17H,4-6,15H2,1-3H3 |
| InChIKey | MELJHHDKEQEMRG-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.93 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|