C19H22ClNO3S — CID 19210421
N-(4-chlorophenyl)sulfonyl-N-(2,5-dimethylphenyl)pentanamide (PubChem CID 19210421) has the molecular formula C19H22ClNO3S and a molecular weight of 379.91 g/mol. Its IUPAC name is N-(4-chlorophenyl)sulfonyl-N-(2,5-dimethylphenyl)pentanamide.
| Compound Name | N-(4-chlorophenyl)sulfonyl-N-(2,5-dimethylphenyl)pentanamide |
|---|---|
| PubChem CID | 19210421 |
| Molecular Formula | C19H22ClNO3S |
| Molecular Weight | 379.91 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | N-(4-chlorophenyl)sulfonyl-N-(2,5-dimethylphenyl)pentanamide |
| SMILES | CCCCC(=O)N(c1cc(C)ccc1C)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H22ClNO3S/c1-4-5-6-19(22)21(18-13-14(2)7-8-15(18)3)25(23,24)17-11-9-16(20)10-12-17/h7-13H,4-6H2,1-3H3 |
| InChIKey | WWPWSTSNCOXTFH-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.91 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |