C19H16ClNO4S — CID 19210451
N-(4-chlorophenyl)sulfonyl-N-(2,5-dimethylphenyl)furan-2-carboxamide (PubChem CID 19210451) has the molecular formula C19H16ClNO4S and a molecular weight of 389.86 g/mol. Its IUPAC name is N-(4-chlorophenyl)sulfonyl-N-(2,5-dimethylphenyl)furan-2-carboxamide.
| Compound Name | N-(4-chlorophenyl)sulfonyl-N-(2,5-dimethylphenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 19210451 |
| Molecular Formula | C19H16ClNO4S |
| Molecular Weight | 389.86 g/mol |
| Exact Mass | 389.05 |
| IUPAC Name | N-(4-chlorophenyl)sulfonyl-N-(2,5-dimethylphenyl)furan-2-carboxamide |
| SMILES | Cc1ccc(C)c(N(C(=O)c2ccco2)S(=O)(=O)c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C19H16ClNO4S/c1-13-5-6-14(2)17(12-13)21(19(22)18-4-3-11-25-18)26(23,24)16-9-7-15(20)8-10-16/h3-12H,1-2H3 |
| InChIKey | RDSFOKLBQTZTAV-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 67.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.86 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |