C21H17Cl2NO3S — CID 19210700
2-chloro-N-(4-chlorophenyl)sulfonyl-N-(2,5-dimethylphenyl)benzamide (PubChem CID 19210700) has the molecular formula C21H17Cl2NO3S and a molecular weight of 434.34 g/mol. Its IUPAC name is 2-chloro-N-(4-chlorophenyl)sulfonyl-N-(2,5-dimethylphenyl)benzamide.
| Compound Name | 2-chloro-N-(4-chlorophenyl)sulfonyl-N-(2,5-dimethylphenyl)benzamide |
|---|---|
| PubChem CID | 19210700 |
| Molecular Formula | C21H17Cl2NO3S |
| Molecular Weight | 434.34 g/mol |
| Exact Mass | 433.03 |
| IUPAC Name | 2-chloro-N-(4-chlorophenyl)sulfonyl-N-(2,5-dimethylphenyl)benzamide |
| SMILES | Cc1ccc(C)c(N(C(=O)c2ccccc2Cl)S(=O)(=O)c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C21H17Cl2NO3S/c1-14-7-8-15(2)20(13-14)24(21(25)18-5-3-4-6-19(18)23)28(26,27)17-11-9-16(22)10-12-17/h3-13H,1-2H3 |
| InChIKey | YOYUAAROESTEMX-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.34 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |