C20H12Cl2F3NO3S — CID 34309505
2-chloro-N-(4-chlorophenyl)sulfonyl-N-[3-(trifluoromethyl)phenyl]benzamide (PubChem CID 34309505) has the molecular formula C20H12Cl2F3NO3S and a molecular weight of 474.29 g/mol. Its IUPAC name is 2-chloro-N-(4-chlorophenyl)sulfonyl-N-[3-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 2-chloro-N-(4-chlorophenyl)sulfonyl-N-[3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 34309505 |
| Molecular Formula | C20H12Cl2F3NO3S |
| Molecular Weight | 474.29 g/mol |
| Exact Mass | 472.99 |
| IUPAC Name | 2-chloro-N-(4-chlorophenyl)sulfonyl-N-[3-(trifluoromethyl)phenyl]benzamide |
| SMILES | O=C(c1ccccc1Cl)N(c1cccc(C(F)(F)F)c1)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H12Cl2F3NO3S/c21-14-8-10-16(11-9-14)30(28,29)26(19(27)17-6-1-2-7-18(17)22)15-5-3-4-13(12-15)20(23,24)25/h1-12H |
| InChIKey | CDRZMBORKLNWIA-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.29 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |