C16H12Cl2F3NO4S — CID 50893228
2-[N-(3,4-dichlorophenyl)sulfonyl-3-(trifluoromethyl)anilino]propanoic acid (PubChem CID 50893228) has the molecular formula C16H12Cl2F3NO4S and a molecular weight of 442.24 g/mol. Its IUPAC name is 2-[N-(3,4-dichlorophenyl)sulfonyl-3-(trifluoromethyl)anilino]propanoic acid.
| Compound Name | 2-[N-(3,4-dichlorophenyl)sulfonyl-3-(trifluoromethyl)anilino]propanoic acid |
|---|---|
| PubChem CID | 50893228 |
| Molecular Formula | C16H12Cl2F3NO4S |
| Molecular Weight | 442.24 g/mol |
| Exact Mass | 440.98 |
| IUPAC Name | 2-[N-(3,4-dichlorophenyl)sulfonyl-3-(trifluoromethyl)anilino]propanoic acid |
| SMILES | CC(C(=O)O)N(c1cccc(C(F)(F)F)c1)S(=O)(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H12Cl2F3NO4S/c1-9(15(23)24)22(11-4-2-3-10(7-11)16(19,20)21)27(25,26)12-5-6-13(17)14(18)8-12/h2-9H,1H3,(H,23,24) |
| InChIKey | XQXDKXFIYUEDRG-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.24 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |