C15H12Cl2FNO4S — CID 50890633
2-(N-(3,4-dichlorophenyl)sulfonyl-4-fluoroanilino)propanoic acid (PubChem CID 50890633) has the molecular formula C15H12Cl2FNO4S and a molecular weight of 392.24 g/mol. Its IUPAC name is 2-(N-(3,4-dichlorophenyl)sulfonyl-4-fluoroanilino)propanoic acid.
| Compound Name | 2-(N-(3,4-dichlorophenyl)sulfonyl-4-fluoroanilino)propanoic acid |
|---|---|
| PubChem CID | 50890633 |
| Molecular Formula | C15H12Cl2FNO4S |
| Molecular Weight | 392.24 g/mol |
| Exact Mass | 390.98 |
| IUPAC Name | 2-(N-(3,4-dichlorophenyl)sulfonyl-4-fluoroanilino)propanoic acid |
| SMILES | CC(C(=O)O)N(c1ccc(F)cc1)S(=O)(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H12Cl2FNO4S/c1-9(15(20)21)19(11-4-2-10(18)3-5-11)24(22,23)12-6-7-13(16)14(17)8-12/h2-9H,1H3,(H,20,21) |
| InChIKey | ZUANKZAHHLIWST-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.24 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |