C17H16ClNO6S — CID 50894699
5-[1-carboxyethyl-(4-methylphenyl)sulfonylamino]-2-chlorobenzoic acid (PubChem CID 50894699) has the molecular formula C17H16ClNO6S and a molecular weight of 397.84 g/mol. Its IUPAC name is 5-[1-carboxyethyl-(4-methylphenyl)sulfonylamino]-2-chlorobenzoic acid.
| Compound Name | 5-[1-carboxyethyl-(4-methylphenyl)sulfonylamino]-2-chlorobenzoic acid |
|---|---|
| PubChem CID | 50894699 |
| Molecular Formula | C17H16ClNO6S |
| Molecular Weight | 397.84 g/mol |
| Exact Mass | 397.04 |
| IUPAC Name | 5-[1-carboxyethyl-(4-methylphenyl)sulfonylamino]-2-chlorobenzoic acid |
| SMILES | Cc1ccc(S(=O)(=O)N(c2ccc(Cl)c(C(=O)O)c2)C(C)C(=O)O)cc1 |
| InChI | InChI=1S/C17H16ClNO6S/c1-10-3-6-13(7-4-10)26(24,25)19(11(2)16(20)21)12-5-8-15(18)14(9-12)17(22)23/h3-9,11H,1-2H3,(H,20,21)(H,22,23) |
| InChIKey | TUWXFEIJDQYPNQ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 111.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.84 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |