C17H19NO5S — CID 50891410
2-(4-methoxy-N-(4-methylphenyl)sulfonylanilino)propanoic acid (PubChem CID 50891410) has the molecular formula C17H19NO5S and a molecular weight of 349.41 g/mol. Its IUPAC name is 2-(4-methoxy-N-(4-methylphenyl)sulfonylanilino)propanoic acid.
| Compound Name | 2-(4-methoxy-N-(4-methylphenyl)sulfonylanilino)propanoic acid |
|---|---|
| PubChem CID | 50891410 |
| Molecular Formula | C17H19NO5S |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | 2-(4-methoxy-N-(4-methylphenyl)sulfonylanilino)propanoic acid |
| SMILES | COc1ccc(N(C(C)C(=O)O)S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C17H19NO5S/c1-12-4-10-16(11-5-12)24(21,22)18(13(2)17(19)20)14-6-8-15(23-3)9-7-14/h4-11,13H,1-3H3,(H,19,20) |
| InChIKey | IUTAMTWHILNZSF-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |