C18H21NO4S — CID 50891983
2-(3,5-dimethyl-N-(4-methylphenyl)sulfonylanilino)propanoic acid (PubChem CID 50891983) has the molecular formula C18H21NO4S and a molecular weight of 347.44 g/mol. Its IUPAC name is 2-(3,5-dimethyl-N-(4-methylphenyl)sulfonylanilino)propanoic acid.
| Compound Name | 2-(3,5-dimethyl-N-(4-methylphenyl)sulfonylanilino)propanoic acid |
|---|---|
| PubChem CID | 50891983 |
| Molecular Formula | C18H21NO4S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | 2-(3,5-dimethyl-N-(4-methylphenyl)sulfonylanilino)propanoic acid |
| SMILES | Cc1ccc(S(=O)(=O)N(c2cc(C)cc(C)c2)C(C)C(=O)O)cc1 |
| InChI | InChI=1S/C18H21NO4S/c1-12-5-7-17(8-6-12)24(22,23)19(15(4)18(20)21)16-10-13(2)9-14(3)11-16/h5-11,15H,1-4H3,(H,20,21) |
| InChIKey | IWTAQNGVABLOMM-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |