C12H17NO4S — CID 67639025
(2S)-2-[ethyl-(4-methylphenyl)sulfonylamino]propanoic acid (PubChem CID 67639025) has the molecular formula C12H17NO4S and a molecular weight of 271.34 g/mol. Its IUPAC name is (2S)-2-[ethyl-(4-methylphenyl)sulfonylamino]propanoic acid.
| Compound Name | (2S)-2-[ethyl-(4-methylphenyl)sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 67639025 |
| Molecular Formula | C12H17NO4S |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | (2S)-2-[ethyl-(4-methylphenyl)sulfonylamino]propanoic acid |
| SMILES | CCN([C@@H](C)C(=O)O)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C12H17NO4S/c1-4-13(10(3)12(14)15)18(16,17)11-7-5-9(2)6-8-11/h5-8,10H,4H2,1-3H3,(H,14,15)/t10-/m0/s1 |
| InChIKey | YYBAEXILLYPUQV-JTQLQIEISA-N |
| XLogP | 1.48 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |