C15H13ClINO4S — CID 50891110
2-(N-(4-chlorophenyl)sulfonyl-4-iodoanilino)propanoic acid (PubChem CID 50891110) has the molecular formula C15H13ClINO4S and a molecular weight of 465.70 g/mol. Its IUPAC name is 2-(N-(4-chlorophenyl)sulfonyl-4-iodoanilino)propanoic acid.
| Compound Name | 2-(N-(4-chlorophenyl)sulfonyl-4-iodoanilino)propanoic acid |
|---|---|
| PubChem CID | 50891110 |
| Molecular Formula | C15H13ClINO4S |
| Molecular Weight | 465.70 g/mol |
| Exact Mass | 464.93 |
| IUPAC Name | 2-(N-(4-chlorophenyl)sulfonyl-4-iodoanilino)propanoic acid |
| SMILES | CC(C(=O)O)N(c1ccc(I)cc1)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H13ClINO4S/c1-10(15(19)20)18(13-6-4-12(17)5-7-13)23(21,22)14-8-2-11(16)3-9-14/h2-10H,1H3,(H,19,20) |
| InChIKey | JAJSGMUJYCLALW-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.70 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|