C19H22ClNO4S — CID 50895805
2-(N-(4-chlorophenyl)sulfonyl-2,6-diethylanilino)propanoic acid (PubChem CID 50895805) has the molecular formula C19H22ClNO4S and a molecular weight of 395.91 g/mol. Its IUPAC name is 2-(N-(4-chlorophenyl)sulfonyl-2,6-diethylanilino)propanoic acid.
| Compound Name | 2-(N-(4-chlorophenyl)sulfonyl-2,6-diethylanilino)propanoic acid |
|---|---|
| PubChem CID | 50895805 |
| Molecular Formula | C19H22ClNO4S |
| Molecular Weight | 395.91 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | 2-(N-(4-chlorophenyl)sulfonyl-2,6-diethylanilino)propanoic acid |
| SMILES | CCc1cccc(CC)c1N(C(C)C(=O)O)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H22ClNO4S/c1-4-14-7-6-8-15(5-2)18(14)21(13(3)19(22)23)26(24,25)17-11-9-16(20)10-12-17/h6-13H,4-5H2,1-3H3,(H,22,23) |
| InChIKey | JWGRPZBKGLQRSP-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.91 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |