C17H18ClNO6S — CID 50895135
2-(N-(4-chlorophenyl)sulfonyl-2,4-dimethoxyanilino)propanoic acid (PubChem CID 50895135) has the molecular formula C17H18ClNO6S and a molecular weight of 399.85 g/mol. Its IUPAC name is 2-(N-(4-chlorophenyl)sulfonyl-2,4-dimethoxyanilino)propanoic acid.
| Compound Name | 2-(N-(4-chlorophenyl)sulfonyl-2,4-dimethoxyanilino)propanoic acid |
|---|---|
| PubChem CID | 50895135 |
| Molecular Formula | C17H18ClNO6S |
| Molecular Weight | 399.85 g/mol |
| Exact Mass | 399.05 |
| IUPAC Name | 2-(N-(4-chlorophenyl)sulfonyl-2,4-dimethoxyanilino)propanoic acid |
| SMILES | COc1ccc(N(C(C)C(=O)O)S(=O)(=O)c2ccc(Cl)cc2)c(OC)c1 |
| InChI | InChI=1S/C17H18ClNO6S/c1-11(17(20)21)19(15-9-6-13(24-2)10-16(15)25-3)26(22,23)14-7-4-12(18)5-8-14/h4-11H,1-3H3,(H,20,21) |
| InChIKey | UTDOQLOFGBODHC-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.85 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |