C19H16ClNO4S — CID 50894055
2-[(4-chlorophenyl)sulfonyl-naphthalen-2-ylamino]propanoic acid (PubChem CID 50894055) has the molecular formula C19H16ClNO4S and a molecular weight of 389.86 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)sulfonyl-naphthalen-2-ylamino]propanoic acid.
| Compound Name | 2-[(4-chlorophenyl)sulfonyl-naphthalen-2-ylamino]propanoic acid |
|---|---|
| PubChem CID | 50894055 |
| Molecular Formula | C19H16ClNO4S |
| Molecular Weight | 389.86 g/mol |
| Exact Mass | 389.05 |
| IUPAC Name | 2-[(4-chlorophenyl)sulfonyl-naphthalen-2-ylamino]propanoic acid |
| SMILES | CC(C(=O)O)N(c1ccc2ccccc2c1)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H16ClNO4S/c1-13(19(22)23)21(26(24,25)18-10-7-16(20)8-11-18)17-9-6-14-4-2-3-5-15(14)12-17/h2-13H,1H3,(H,22,23) |
| InChIKey | BNAGULJXGDVGFM-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.86 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |