C19H17ClN2O4S — CID 72945426
(2S)-2-(4-chloro-N-naphthalen-2-ylsulfonylanilino)-N-hydroxypropanamide (PubChem CID 72945426) has the molecular formula C19H17ClN2O4S and a molecular weight of 404.88 g/mol. Its IUPAC name is (2S)-2-(4-chloro-N-naphthalen-2-ylsulfonylanilino)-N-hydroxypropanamide.
| Compound Name | (2S)-2-(4-chloro-N-naphthalen-2-ylsulfonylanilino)-N-hydroxypropanamide |
|---|---|
| PubChem CID | 72945426 |
| Molecular Formula | C19H17ClN2O4S |
| Molecular Weight | 404.88 g/mol |
| Exact Mass | 404.06 |
| IUPAC Name | (2S)-2-(4-chloro-N-naphthalen-2-ylsulfonylanilino)-N-hydroxypropanamide |
| SMILES | C[C@@H](C(=O)NO)N(c1ccc(Cl)cc1)S(=O)(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C19H17ClN2O4S/c1-13(19(23)21-24)22(17-9-7-16(20)8-10-17)27(25,26)18-11-6-14-4-2-3-5-15(14)12-18/h2-13,24H,1H3,(H,21,23)/t13-/m0/s1 |
| InChIKey | ZCWYTXLVKZIACQ-ZDUSSCGKSA-N |
| XLogP | 3.58 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.88 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|