C23H25ClN2O5S — CID 58256217
(2R)-2-[2-(4-chlorophenoxy)ethyl-naphthalen-2-ylsulfonylamino]-N-hydroxy-3-methylbutanamide (PubChem CID 58256217) has the molecular formula C23H25ClN2O5S and a molecular weight of 476.98 g/mol. Its IUPAC name is (2R)-2-[2-(4-chlorophenoxy)ethyl-naphthalen-2-ylsulfonylamino]-N-hydroxy-3-methylbutanamide.
| Compound Name | (2R)-2-[2-(4-chlorophenoxy)ethyl-naphthalen-2-ylsulfonylamino]-N-hydroxy-3-methylbutanamide |
|---|---|
| PubChem CID | 58256217 |
| Molecular Formula | C23H25ClN2O5S |
| Molecular Weight | 476.98 g/mol |
| Exact Mass | 476.12 |
| IUPAC Name | (2R)-2-[2-(4-chlorophenoxy)ethyl-naphthalen-2-ylsulfonylamino]-N-hydroxy-3-methylbutanamide |
| SMILES | CC(C)[C@H](C(=O)NO)N(CCOc1ccc(Cl)cc1)S(=O)(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C23H25ClN2O5S/c1-16(2)22(23(27)25-28)26(13-14-31-20-10-8-19(24)9-11-20)32(29,30)21-12-7-17-5-3-4-6-18(17)15-21/h3-12,15-16,22,28H,13-14H2,1-2H3,(H,25,27)/t22-/m1/s1 |
| InChIKey | MRZPACFXMSIJGV-JOCHJYFZSA-N |
| XLogP | 4.09 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.98 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|