C23H27N3O5S — CID 58256181
(2R)-2-[(7-ethoxynaphthalen-2-yl)sulfonyl-(pyridin-3-ylmethyl)amino]-N-hydroxy-3-methylbutanamide (PubChem CID 58256181) has the molecular formula C23H27N3O5S and a molecular weight of 457.55 g/mol. Its IUPAC name is (2R)-2-[(7-ethoxynaphthalen-2-yl)sulfonyl-(pyridin-3-ylmethyl)amino]-N-hydroxy-3-methylbutanamide.
| Compound Name | (2R)-2-[(7-ethoxynaphthalen-2-yl)sulfonyl-(pyridin-3-ylmethyl)amino]-N-hydroxy-3-methylbutanamide |
|---|---|
| PubChem CID | 58256181 |
| Molecular Formula | C23H27N3O5S |
| Molecular Weight | 457.55 g/mol |
| Exact Mass | 457.17 |
| IUPAC Name | (2R)-2-[(7-ethoxynaphthalen-2-yl)sulfonyl-(pyridin-3-ylmethyl)amino]-N-hydroxy-3-methylbutanamide |
| SMILES | CCOc1ccc2ccc(S(=O)(=O)N(Cc3cccnc3)[C@@H](C(=O)NO)C(C)C)cc2c1 |
| InChI | InChI=1S/C23H27N3O5S/c1-4-31-20-9-7-18-8-10-21(13-19(18)12-20)32(29,30)26(15-17-6-5-11-24-14-17)22(16(2)3)23(27)25-28/h5-14,16,22,28H,4,15H2,1-3H3,(H,25,27)/t22-/m1/s1 |
| InChIKey | QJAZJVWOWPUYNR-JOCHJYFZSA-N |
| XLogP | 3.35 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.55 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|