C19H25N3O5S — CID 10971531
(2R)-N-(111C)methoxy-2-[(4-methoxyphenyl)sulfonyl-(pyridin-3-ylmethyl)amino]-3-methylbutanamide (PubChem CID 10971531) has the molecular formula C19H25N3O5S and a molecular weight of 406.49 g/mol. Its IUPAC name is (2R)-N-(111C)methoxy-2-[(4-methoxyphenyl)sulfonyl-(pyridin-3-ylmethyl)amino]-3-methylbutanamide.
| Compound Name | (2R)-N-(111C)methoxy-2-[(4-methoxyphenyl)sulfonyl-(pyridin-3-ylmethyl)amino]-3-methylbutanamide |
|---|---|
| PubChem CID | 10971531 |
| Molecular Formula | C19H25N3O5S |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | (2R)-N-(111C)methoxy-2-[(4-methoxyphenyl)sulfonyl-(pyridin-3-ylmethyl)amino]-3-methylbutanamide |
| SMILES | COc1ccc(S(=O)(=O)N(Cc2cccnc2)[C@@H](C(=O)NO[11CH3])C(C)C)cc1 |
| InChI | InChI=1S/C19H25N3O5S/c1-14(2)18(19(23)21-27-4)22(13-15-6-5-11-20-12-15)28(24,25)17-9-7-16(26-3)8-10-17/h5-12,14,18H,13H2,1-4H3,(H,21,23)/t18-/m1/s1/i4-1 |
| InChIKey | VPJJCPFANUTTHA-FKNUTUGJSA-N |
| XLogP | 1.98 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|