C18H22FN3O5S — CID 10319425
(2R)-2-[(2-fluoro-4-methoxyphenyl)sulfonyl-(pyridin-3-ylmethyl)amino]-N-hydroxy-3-methylbutanamide (PubChem CID 10319425) has the molecular formula C18H22FN3O5S and a molecular weight of 411.46 g/mol. Its IUPAC name is (2R)-2-[(2-fluoro-4-methoxyphenyl)sulfonyl-(pyridin-3-ylmethyl)amino]-N-hydroxy-3-methylbutanamide.
| Compound Name | (2R)-2-[(2-fluoro-4-methoxyphenyl)sulfonyl-(pyridin-3-ylmethyl)amino]-N-hydroxy-3-methylbutanamide |
|---|---|
| PubChem CID | 10319425 |
| Molecular Formula | C18H22FN3O5S |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | (2R)-2-[(2-fluoro-4-methoxyphenyl)sulfonyl-(pyridin-3-ylmethyl)amino]-N-hydroxy-3-methylbutanamide |
| SMILES | COc1ccc(S(=O)(=O)N(Cc2cccnc2)[C@@H](C(=O)NO)C(C)C)c(F)c1 |
| InChI | InChI=1S/C18H22FN3O5S/c1-12(2)17(18(23)21-24)22(11-13-5-4-8-20-10-13)28(25,26)16-7-6-14(27-3)9-15(16)19/h4-10,12,17,24H,11H2,1-3H3,(H,21,23)/t17-/m1/s1 |
| InChIKey | MUAFUHIXMDRFMK-QGZVFWFLSA-N |
| XLogP | 1.95 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|